![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | A Brief Introduction to the Intuitionistic Propositional Calculus.pdf | 2024-09-18 17:21 | 197K | |
![[ ]](/icons/layout.gif) | Types and Programming Languages.pdf | 2023-09-28 07:17 | 2.1M | |
![[ ]](/icons/layout.gif) | Type Theory and Formal Proof.pdf | 2023-09-28 07:17 | 2.3M | |
![[ ]](/icons/layout.gif) | Homotopy Type Theory.pdf | 2023-09-28 07:17 | 3.1M | |
![[ ]](/icons/layout.gif) | propositions-as-types.pdf | 2023-09-28 07:16 | 805K | |
![[ ]](/icons/layout.gif) | lec15-curryhoward.pdf | 2023-09-28 07:16 | 176K | |
![[ ]](/icons/layout.gif) | Cauchy's functional equation - Wikipedia.pdf | 2023-09-26 01:49 | 1.3M | |
![[ ]](/icons/layout.gif) | induction-coinduction.pdf | 2023-09-26 01:46 | 35K | |
![[ ]](/icons/layout.gif) | Solovay-ModelSetTheoryEvery-1970.pdf | 2023-09-26 01:39 | 3.6M | |
![[ ]](/icons/layout.gif) | banach-tarski.pdf | 2023-09-26 01:39 | 152K | |
![[ ]](/icons/layout.gif) | notes_ac.pdf | 2023-09-26 01:39 | 188K | |
![[ ]](/icons/layout.gif) | Jech - Set Theory.pdf | 2023-09-26 01:39 | 5.9M | |
![[ ]](/icons/layout.gif) | Sequents and Trees (Andrzej Indrzejczak).pdf | 2023-09-21 07:03 | 4.9M | |
![[ ]](/icons/layout.gif) | Logic and Structure.pdf | 2023-09-21 07:03 | 2.4M | |
![[ ]](/icons/layout.gif) | Notes on Godel's incompleteness theorem.pdf | 2023-09-21 07:03 | 1.4M | |
|