![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| A Brief Introduction to the Intuitionistic Propositional Calculus.pdf | 2024-09-18 17:21 | 197K | |
| Types and Programming Languages.pdf | 2023-09-28 07:17 | 2.1M | |
| Type Theory and Formal Proof.pdf | 2023-09-28 07:17 | 2.3M | |
| Homotopy Type Theory.pdf | 2023-09-28 07:17 | 3.1M | |
| propositions-as-types.pdf | 2023-09-28 07:16 | 805K | |
| lec15-curryhoward.pdf | 2023-09-28 07:16 | 176K | |
| Cauchy's functional equation - Wikipedia.pdf | 2023-09-26 01:49 | 1.3M | |
| induction-coinduction.pdf | 2023-09-26 01:46 | 35K | |
| Solovay-ModelSetTheoryEvery-1970.pdf | 2023-09-26 01:39 | 3.6M | |
| banach-tarski.pdf | 2023-09-26 01:39 | 152K | |
| notes_ac.pdf | 2023-09-26 01:39 | 188K | |
| Jech - Set Theory.pdf | 2023-09-26 01:39 | 5.9M | |
| Sequents and Trees (Andrzej Indrzejczak).pdf | 2023-09-21 07:03 | 4.9M | |
| Logic and Structure.pdf | 2023-09-21 07:03 | 2.4M | |
| Notes on Godel's incompleteness theorem.pdf | 2023-09-21 07:03 | 1.4M | |